C23H16ClN3O3S — CID 125117518
6-(4-chlorophenyl)-2-[(3R)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpyridine-3-carbonitrile (PubChem CID 125117518) has the molecular formula C23H16ClN3O3S and a molecular weight of 449.92 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-2-[(3R)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpyridine-3-carbonitrile.
| Compound Name | 6-(4-chlorophenyl)-2-[(3R)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 125117518 |
| Molecular Formula | C23H16ClN3O3S |
| Molecular Weight | 449.92 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | 6-(4-chlorophenyl)-2-[(3R)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpyridine-3-carbonitrile |
| SMILES | COc1ccc(N2C(=O)C[C@@H](Sc3nc(-c4ccc(Cl)cc4)ccc3C#N)C2=O)cc1 |
| InChI | InChI=1S/C23H16ClN3O3S/c1-30-18-9-7-17(8-10-18)27-21(28)12-20(23(27)29)31-22-15(13-25)4-11-19(26-22)14-2-5-16(24)6-3-14/h2-11,20H,12H2,1H3/t20-/m1/s1 |
| InChIKey | GAZFOYZPRSGXNO-HXUWFJFHSA-N |
| XLogP | 4.71 |
| TPSA | 83.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.92 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|