C20H19N3O3S — CID 1070846
2-[(3S)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanyl-6-propylpyridine-3-carbonitrile (PubChem CID 1070846) has the molecular formula C20H19N3O3S and a molecular weight of 381.46 g/mol. Its IUPAC name is 2-[(3S)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanyl-6-propylpyridine-3-carbonitrile.
| Compound Name | 2-[(3S)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanyl-6-propylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 1070846 |
| Molecular Formula | C20H19N3O3S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 2-[(3S)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanyl-6-propylpyridine-3-carbonitrile |
| SMILES | CCCc1ccc(C#N)c(S[C@H]2CC(=O)N(c3ccc(OC)cc3)C2=O)n1 |
| InChI | InChI=1S/C20H19N3O3S/c1-3-4-14-6-5-13(12-21)19(22-14)27-17-11-18(24)23(20(17)25)15-7-9-16(26-2)10-8-15/h5-10,17H,3-4,11H2,1-2H3/t17-/m0/s1 |
| InChIKey | SUGAQCQEHDWPMD-KRWDZBQOSA-N |
| XLogP | 3.34 |
| TPSA | 83.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|