C19H17N3O3S — CID 1230314
2-[(3S)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanyl-6-methylpyridine-3-carbonitrile (PubChem CID 1230314) has the molecular formula C19H17N3O3S and a molecular weight of 367.43 g/mol. Its IUPAC name is 2-[(3S)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanyl-6-methylpyridine-3-carbonitrile.
| Compound Name | 2-[(3S)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanyl-6-methylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 1230314 |
| Molecular Formula | C19H17N3O3S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 2-[(3S)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanyl-6-methylpyridine-3-carbonitrile |
| SMILES | CCOc1ccc(N2C(=O)C[C@H](Sc3nc(C)ccc3C#N)C2=O)cc1 |
| InChI | InChI=1S/C19H17N3O3S/c1-3-25-15-8-6-14(7-9-15)22-17(23)10-16(19(22)24)26-18-13(11-20)5-4-12(2)21-18/h4-9,16H,3,10H2,1-2H3/t16-/m0/s1 |
| InChIKey | BNZFOOYWJQINPM-INIZCTEOSA-N |
| XLogP | 3.08 |
| TPSA | 83.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|