C25H21N3O3S — CID 23917057
2-[2,5-dioxo-1-(4-phenoxyphenyl)pyrrolidin-3-yl]sulfanyl-6-propylpyridine-3-carbonitrile (PubChem CID 23917057) has the molecular formula C25H21N3O3S and a molecular weight of 443.53 g/mol. Its IUPAC name is 2-[2,5-dioxo-1-(4-phenoxyphenyl)pyrrolidin-3-yl]sulfanyl-6-propylpyridine-3-carbonitrile.
| Compound Name | 2-[2,5-dioxo-1-(4-phenoxyphenyl)pyrrolidin-3-yl]sulfanyl-6-propylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 23917057 |
| Molecular Formula | C25H21N3O3S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 2-[2,5-dioxo-1-(4-phenoxyphenyl)pyrrolidin-3-yl]sulfanyl-6-propylpyridine-3-carbonitrile |
| SMILES | CCCc1ccc(C#N)c(SC2CC(=O)N(c3ccc(Oc4ccccc4)cc3)C2=O)n1 |
| InChI | InChI=1S/C25H21N3O3S/c1-2-6-18-10-9-17(16-26)24(27-18)32-22-15-23(29)28(25(22)30)19-11-13-21(14-12-19)31-20-7-4-3-5-8-20/h3-5,7-14,22H,2,6,15H2,1H3 |
| InChIKey | ZBAPKUCSIZVMLJ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 83.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|