C20H16N4O2S — CID 23861067
2-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanyl-6-propylpyridine-3-carbonitrile (PubChem CID 23861067) has the molecular formula C20H16N4O2S and a molecular weight of 376.44 g/mol. Its IUPAC name is 2-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanyl-6-propylpyridine-3-carbonitrile.
| Compound Name | 2-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanyl-6-propylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 23861067 |
| Molecular Formula | C20H16N4O2S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 2-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanyl-6-propylpyridine-3-carbonitrile |
| SMILES | CCCc1ccc(C#N)c(SC2CC(=O)N(c3ccc(C#N)cc3)C2=O)n1 |
| InChI | InChI=1S/C20H16N4O2S/c1-2-3-15-7-6-14(12-22)19(23-15)27-17-10-18(25)24(20(17)26)16-8-4-13(11-21)5-9-16/h4-9,17H,2-3,10H2,1H3 |
| InChIKey | JERREKDPZFANDX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 97.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|