C14H14NO4S- — CID 6922257
2-[(3R)-2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl]sulfanylbenzoate (PubChem CID 6922257) has the molecular formula C14H14NO4S- and a molecular weight of 292.34 g/mol. Its IUPAC name is 2-[(3R)-2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl]sulfanylbenzoate.
| Compound Name | 2-[(3R)-2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl]sulfanylbenzoate |
|---|---|
| PubChem CID | 6922257 |
| Molecular Formula | C14H14NO4S- |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 2-[(3R)-2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl]sulfanylbenzoate |
| SMILES | CC(C)N1C(=O)C[C@@H](Sc2ccccc2C(=O)[O-])C1=O |
| InChI | InChI=1S/C14H15NO4S/c1-8(2)15-12(16)7-11(13(15)17)20-10-6-4-3-5-9(10)14(18)19/h3-6,8,11H,7H2,1-2H3,(H,18,19)/p-1/t11-/m1/s1 |
| InChIKey | MRIQQRXUKPABAK-LLVKDONJSA-M |
| XLogP | 0.68 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|