C12H19NO3S2 — CID 130352569
3-[(3-methyl-2-oxobutyl)disulfanyl]-1-propan-2-ylpyrrolidine-2,5-dione (PubChem CID 130352569) has the molecular formula C12H19NO3S2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 3-[(3-methyl-2-oxobutyl)disulfanyl]-1-propan-2-ylpyrrolidine-2,5-dione.
| Compound Name | 3-[(3-methyl-2-oxobutyl)disulfanyl]-1-propan-2-ylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 130352569 |
| Molecular Formula | C12H19NO3S2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 3-[(3-methyl-2-oxobutyl)disulfanyl]-1-propan-2-ylpyrrolidine-2,5-dione |
| SMILES | CC(C)C(=O)CSSC1CC(=O)N(C(C)C)C1=O |
| InChI | InChI=1S/C12H19NO3S2/c1-7(2)9(14)6-17-18-10-5-11(15)13(8(3)4)12(10)16/h7-8,10H,5-6H2,1-4H3 |
| InChIKey | DCZPWZRQCQSNFB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|