C23H16BrFN2O3S — CID 23099963
N-[4-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-2-fluorobenzamide (PubChem CID 23099963) has the molecular formula C23H16BrFN2O3S and a molecular weight of 499.36 g/mol. Its IUPAC name is N-[4-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-2-fluorobenzamide.
| Compound Name | N-[4-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 23099963 |
| Molecular Formula | C23H16BrFN2O3S |
| Molecular Weight | 499.36 g/mol |
| Exact Mass | 498.00 |
| IUPAC Name | N-[4-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-2-fluorobenzamide |
| SMILES | O=C(Nc1ccc(SC2CC(=O)N(c3ccc(Br)cc3)C2=O)cc1)c1ccccc1F |
| InChI | InChI=1S/C23H16BrFN2O3S/c24-14-5-9-16(10-6-14)27-21(28)13-20(23(27)30)31-17-11-7-15(8-12-17)26-22(29)18-3-1-2-4-19(18)25/h1-12,20H,13H2,(H,26,29) |
| InChIKey | PFOJUJRHAKSOAI-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.36 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|