C25H21BrN2O5S — CID 21169032
N-[4-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-3,4-dimethoxybenzamide (PubChem CID 21169032) has the molecular formula C25H21BrN2O5S and a molecular weight of 541.42 g/mol. Its IUPAC name is N-[4-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[4-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 21169032 |
| Molecular Formula | C25H21BrN2O5S |
| Molecular Weight | 541.42 g/mol |
| Exact Mass | 540.04 |
| IUPAC Name | N-[4-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(SC3CC(=O)N(c4ccc(Br)cc4)C3=O)cc2)cc1OC |
| InChI | InChI=1S/C25H21BrN2O5S/c1-32-20-12-3-15(13-21(20)33-2)24(30)27-17-6-10-19(11-7-17)34-22-14-23(29)28(25(22)31)18-8-4-16(26)5-9-18/h3-13,22H,14H2,1-2H3,(H,27,30) |
| InChIKey | PSBKCVOJMXFGAH-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.42 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|