C28H28N2O5S — CID 23100505
N-[4-[1-(4-butoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-4-methoxybenzamide (PubChem CID 23100505) has the molecular formula C28H28N2O5S and a molecular weight of 504.61 g/mol. Its IUPAC name is N-[4-[1-(4-butoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-4-methoxybenzamide.
| Compound Name | N-[4-[1-(4-butoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 23100505 |
| Molecular Formula | C28H28N2O5S |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | N-[4-[1-(4-butoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-4-methoxybenzamide |
| SMILES | CCCCOc1ccc(N2C(=O)CC(Sc3ccc(NC(=O)c4ccc(OC)cc4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C28H28N2O5S/c1-3-4-17-35-23-13-9-21(10-14-23)30-26(31)18-25(28(30)33)36-24-15-7-20(8-16-24)29-27(32)19-5-11-22(34-2)12-6-19/h5-16,25H,3-4,17-18H2,1-2H3,(H,29,32) |
| InChIKey | FQEWUUBHCXUTAM-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|