C26H23N3O5S — CID 23098968
N-[4-[1-(4-acetamidophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-3-methoxybenzamide (PubChem CID 23098968) has the molecular formula C26H23N3O5S and a molecular weight of 489.55 g/mol. Its IUPAC name is N-[4-[1-(4-acetamidophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-3-methoxybenzamide.
| Compound Name | N-[4-[1-(4-acetamidophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 23098968 |
| Molecular Formula | C26H23N3O5S |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | N-[4-[1-(4-acetamidophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)Nc2ccc(SC3CC(=O)N(c4ccc(NC(C)=O)cc4)C3=O)cc2)c1 |
| InChI | InChI=1S/C26H23N3O5S/c1-16(30)27-18-6-10-20(11-7-18)29-24(31)15-23(26(29)33)35-22-12-8-19(9-13-22)28-25(32)17-4-3-5-21(14-17)34-2/h3-14,23H,15H2,1-2H3,(H,27,30)(H,28,32) |
| InChIKey | FCROKQSQFPKGBZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|