C24H20N2O4S — CID 22779670
N-[4-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanylphenyl]-4-methoxybenzamide (PubChem CID 22779670) has the molecular formula C24H20N2O4S and a molecular weight of 432.50 g/mol. Its IUPAC name is N-[4-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanylphenyl]-4-methoxybenzamide.
| Compound Name | N-[4-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanylphenyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 22779670 |
| Molecular Formula | C24H20N2O4S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | N-[4-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanylphenyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(SC3CC(=O)N(c4ccccc4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C24H20N2O4S/c1-30-19-11-7-16(8-12-19)23(28)25-17-9-13-20(14-10-17)31-21-15-22(27)26(24(21)29)18-5-3-2-4-6-18/h2-14,21H,15H2,1H3,(H,25,28) |
| InChIKey | AUYLMAAKWVUSMF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|