C26H22N2O6S — CID 99128945
2-[[4-[(3S)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]carbamoyl]benzoic acid (PubChem CID 99128945) has the molecular formula C26H22N2O6S and a molecular weight of 490.54 g/mol. Its IUPAC name is 2-[[4-[(3S)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2-[[4-[(3S)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 99128945 |
| Molecular Formula | C26H22N2O6S |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | 2-[[4-[(3S)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]carbamoyl]benzoic acid |
| SMILES | CCOc1ccc(N2C(=O)C[C@H](Sc3ccc(NC(=O)c4ccccc4C(=O)O)cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H22N2O6S/c1-2-34-18-11-9-17(10-12-18)28-23(29)15-22(25(28)31)35-19-13-7-16(8-14-19)27-24(30)20-5-3-4-6-21(20)26(32)33/h3-14,22H,2,15H2,1H3,(H,27,30)(H,32,33)/t22-/m0/s1 |
| InChIKey | WIQFQLURZJSFLS-QFIPXVFZSA-N |
| XLogP | 4.46 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|