C25H23N3O4S — CID 19057766
1-[3-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-3-phenylurea (PubChem CID 19057766) has the molecular formula C25H23N3O4S and a molecular weight of 461.54 g/mol. Its IUPAC name is 1-[3-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-3-phenylurea.
| Compound Name | 1-[3-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-3-phenylurea |
|---|---|
| PubChem CID | 19057766 |
| Molecular Formula | C25H23N3O4S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 1-[3-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-3-phenylurea |
| SMILES | CCOc1ccc(N2C(=O)CC(Sc3cccc(NC(=O)Nc4ccccc4)c3)C2=O)cc1 |
| InChI | InChI=1S/C25H23N3O4S/c1-2-32-20-13-11-19(12-14-20)28-23(29)16-22(24(28)30)33-21-10-6-9-18(15-21)27-25(31)26-17-7-4-3-5-8-17/h3-15,22H,2,16H2,1H3,(H2,26,27,31) |
| InChIKey | YZMYQTSRKAJPOE-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|