C22H22N2O6S — CID 22781472
4-[4-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-4-oxobutanoic acid (PubChem CID 22781472) has the molecular formula C22H22N2O6S and a molecular weight of 442.49 g/mol. Its IUPAC name is 4-[4-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-4-oxobutanoic acid.
| Compound Name | 4-[4-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22781472 |
| Molecular Formula | C22H22N2O6S |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 4-[4-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-4-oxobutanoic acid |
| SMILES | CCOc1ccc(N2C(=O)CC(Sc3ccc(NC(=O)CCC(=O)O)cc3)C2=O)cc1 |
| InChI | InChI=1S/C22H22N2O6S/c1-2-30-16-7-5-15(6-8-16)24-20(26)13-18(22(24)29)31-17-9-3-14(4-10-17)23-19(25)11-12-21(27)28/h3-10,18H,2,11-13H2,1H3,(H,23,25)(H,27,28) |
| InChIKey | IJNRZXUWGNPKIB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|