C21H19ClN2O6S — CID 99129111
4-[4-[(3S)-1-(3-chloro-4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-4-oxobutanoic acid (PubChem CID 99129111) has the molecular formula C21H19ClN2O6S and a molecular weight of 462.91 g/mol. Its IUPAC name is 4-[4-[(3S)-1-(3-chloro-4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-4-oxobutanoic acid.
| Compound Name | 4-[4-[(3S)-1-(3-chloro-4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 99129111 |
| Molecular Formula | C21H19ClN2O6S |
| Molecular Weight | 462.91 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | 4-[4-[(3S)-1-(3-chloro-4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-4-oxobutanoic acid |
| SMILES | COc1ccc(N2C(=O)C[C@H](Sc3ccc(NC(=O)CCC(=O)O)cc3)C2=O)cc1Cl |
| InChI | InChI=1S/C21H19ClN2O6S/c1-30-16-7-4-13(10-15(16)22)24-19(26)11-17(21(24)29)31-14-5-2-12(3-6-14)23-18(25)8-9-20(27)28/h2-7,10,17H,8-9,11H2,1H3,(H,23,25)(H,27,28)/t17-/m0/s1 |
| InChIKey | HZVKXNXAKWSDDD-KRWDZBQOSA-N |
| XLogP | 3.58 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.91 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|