C24H20ClN3O3S2 — CID 99128950
1-[4-[(3S)-1-(3-chloro-4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-3-phenylthiourea (PubChem CID 99128950) has the molecular formula C24H20ClN3O3S2 and a molecular weight of 498.03 g/mol. Its IUPAC name is 1-[4-[(3S)-1-(3-chloro-4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-3-phenylthiourea.
| Compound Name | 1-[4-[(3S)-1-(3-chloro-4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 99128950 |
| Molecular Formula | C24H20ClN3O3S2 |
| Molecular Weight | 498.03 g/mol |
| Exact Mass | 497.06 |
| IUPAC Name | 1-[4-[(3S)-1-(3-chloro-4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-3-phenylthiourea |
| SMILES | COc1ccc(N2C(=O)C[C@H](Sc3ccc(NC(=S)Nc4ccccc4)cc3)C2=O)cc1Cl |
| InChI | InChI=1S/C24H20ClN3O3S2/c1-31-20-12-9-17(13-19(20)25)28-22(29)14-21(23(28)30)33-18-10-7-16(8-11-18)27-24(32)26-15-5-3-2-4-6-15/h2-13,21H,14H2,1H3,(H2,26,27,32)/t21-/m0/s1 |
| InChIKey | JHJZFVOPVXZOOE-NRFANRHFSA-N |
| XLogP | 5.58 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.03 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|