C33H25ClN4O7S — CID 99679805
N-[(Z)-3-[3-[(3R)-1-(3-chloro-4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 99679805) has the molecular formula C33H25ClN4O7S and a molecular weight of 657.10 g/mol. Its IUPAC name is N-[(Z)-3-[3-[(3R)-1-(3-chloro-4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[(3R)-1-(3-chloro-4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 99679805 |
| Molecular Formula | C33H25ClN4O7S |
| Molecular Weight | 657.10 g/mol |
| Exact Mass | 656.11 |
| IUPAC Name | N-[(Z)-3-[3-[(3R)-1-(3-chloro-4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(N2C(=O)C[C@@H](Sc3cccc(NC(=O)/C(=C/c4ccc([N+](=O)[O-])cc4)NC(=O)c4ccccc4)c3)C2=O)cc1Cl |
| InChI | InChI=1S/C33H25ClN4O7S/c1-45-28-15-14-24(18-26(28)34)37-30(39)19-29(33(37)42)46-25-9-5-8-22(17-25)35-32(41)27(36-31(40)21-6-3-2-4-7-21)16-20-10-12-23(13-11-20)38(43)44/h2-18,29H,19H2,1H3,(H,35,41)(H,36,40)/b27-16-/t29-/m1/s1 |
| InChIKey | KFFAVHGWXZNRNG-YVBHXKDBSA-N |
| XLogP | 6.09 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.10 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|