C32H23IN4O6S — CID 99679560
N-[(Z)-3-[3-[(3S)-1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 99679560) has the molecular formula C32H23IN4O6S and a molecular weight of 718.53 g/mol. Its IUPAC name is N-[(Z)-3-[3-[(3S)-1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[(3S)-1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 99679560 |
| Molecular Formula | C32H23IN4O6S |
| Molecular Weight | 718.53 g/mol |
| Exact Mass | 718.04 |
| IUPAC Name | N-[(Z)-3-[3-[(3S)-1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1cccc(S[C@H]2CC(=O)N(c3ccc(I)cc3)C2=O)c1)/C(=C/c1ccc([N+](=O)[O-])cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C32H23IN4O6S/c33-22-11-15-24(16-12-22)36-29(38)19-28(32(36)41)44-26-8-4-7-23(18-26)34-31(40)27(35-30(39)21-5-2-1-3-6-21)17-20-9-13-25(14-10-20)37(42)43/h1-18,28H,19H2,(H,34,40)(H,35,39)/b27-17-/t28-/m0/s1 |
| InChIKey | IQMINXWVVKURDS-WAWVYTBHSA-N |
| XLogP | 6.03 |
| TPSA | 138.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.53 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|