C35H28N4O8S — CID 99679842
ethyl 4-[(3S)-3-[3-[[(Z)-2-benzamido-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 99679842) has the molecular formula C35H28N4O8S and a molecular weight of 664.70 g/mol. Its IUPAC name is ethyl 4-[(3S)-3-[3-[[(Z)-2-benzamido-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[(3S)-3-[3-[[(Z)-2-benzamido-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 99679842 |
| Molecular Formula | C35H28N4O8S |
| Molecular Weight | 664.70 g/mol |
| Exact Mass | 664.16 |
| IUPAC Name | ethyl 4-[(3S)-3-[3-[[(Z)-2-benzamido-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C[C@H](Sc3cccc(NC(=O)/C(=C/c4ccc([N+](=O)[O-])cc4)NC(=O)c4ccccc4)c3)C2=O)cc1 |
| InChI | InChI=1S/C35H28N4O8S/c1-2-47-35(44)24-13-17-26(18-14-24)38-31(40)21-30(34(38)43)48-28-10-6-9-25(20-28)36-33(42)29(37-32(41)23-7-4-3-5-8-23)19-22-11-15-27(16-12-22)39(45)46/h3-20,30H,2,21H2,1H3,(H,36,42)(H,37,41)/b29-19-/t30-/m0/s1 |
| InChIKey | POEHSGDNAQLDHB-LVBXYETJSA-N |
| XLogP | 5.61 |
| TPSA | 165.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.70 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|