C37H33N3O8S — CID 124657270
ethyl 4-[(3S)-3-[3-[[(E)-2-benzamido-3-(2,3-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 124657270) has the molecular formula C37H33N3O8S and a molecular weight of 679.75 g/mol. Its IUPAC name is ethyl 4-[(3S)-3-[3-[[(E)-2-benzamido-3-(2,3-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[(3S)-3-[3-[[(E)-2-benzamido-3-(2,3-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 124657270 |
| Molecular Formula | C37H33N3O8S |
| Molecular Weight | 679.75 g/mol |
| Exact Mass | 679.20 |
| IUPAC Name | ethyl 4-[(3S)-3-[3-[[(E)-2-benzamido-3-(2,3-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C[C@H](Sc3cccc(NC(=O)/C(=C\c4cccc(OC)c4OC)NC(=O)c4ccccc4)c3)C2=O)cc1 |
| InChI | InChI=1S/C37H33N3O8S/c1-4-48-37(45)24-16-18-27(19-17-24)40-32(41)22-31(36(40)44)49-28-14-9-13-26(21-28)38-35(43)29(39-34(42)23-10-6-5-7-11-23)20-25-12-8-15-30(46-2)33(25)47-3/h5-21,31H,4,22H2,1-3H3,(H,38,43)(H,39,42)/b29-20+/t31-/m0/s1 |
| InChIKey | NOKXJZBFPKSULB-GJKZIJEQSA-N |
| XLogP | 5.71 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.75 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|