C34H27Cl2N3O6S — CID 99679778
N-[(Z)-3-[3-[(3R)-1-(2,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-1-(2,3-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 99679778) has the molecular formula C34H27Cl2N3O6S and a molecular weight of 676.58 g/mol. Its IUPAC name is N-[(Z)-3-[3-[(3R)-1-(2,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-1-(2,3-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[(3R)-1-(2,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-1-(2,3-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 99679778 |
| Molecular Formula | C34H27Cl2N3O6S |
| Molecular Weight | 676.58 g/mol |
| Exact Mass | 675.10 |
| IUPAC Name | N-[(Z)-3-[3-[(3R)-1-(2,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-1-(2,3-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1cccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2cccc(S[C@@H]3CC(=O)N(c4cc(Cl)ccc4Cl)C3=O)c2)c1OC |
| InChI | InChI=1S/C34H27Cl2N3O6S/c1-44-28-13-6-10-21(31(28)45-2)16-26(38-32(41)20-8-4-3-5-9-20)33(42)37-23-11-7-12-24(18-23)46-29-19-30(40)39(34(29)43)27-17-22(35)14-15-25(27)36/h3-18,29H,19H2,1-2H3,(H,37,42)(H,38,41)/b26-16-/t29-/m1/s1 |
| InChIKey | JLTLZIJXZIPBIU-CWJUKMOQSA-N |
| XLogP | 6.84 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.58 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|