C34H28N4O8S — CID 19057631
N-[(Z)-1-(2,3-dimethoxyphenyl)-3-[3-[1-(4-nitrophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19057631) has the molecular formula C34H28N4O8S and a molecular weight of 652.69 g/mol. Its IUPAC name is N-[(Z)-1-(2,3-dimethoxyphenyl)-3-[3-[1-(4-nitrophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2,3-dimethoxyphenyl)-3-[3-[1-(4-nitrophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19057631 |
| Molecular Formula | C34H28N4O8S |
| Molecular Weight | 652.69 g/mol |
| Exact Mass | 652.16 |
| IUPAC Name | N-[(Z)-1-(2,3-dimethoxyphenyl)-3-[3-[1-(4-nitrophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1cccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2cccc(SC3CC(=O)N(c4ccc([N+](=O)[O-])cc4)C3=O)c2)c1OC |
| InChI | InChI=1S/C34H28N4O8S/c1-45-28-13-6-10-22(31(28)46-2)18-27(36-32(40)21-8-4-3-5-9-21)33(41)35-23-11-7-12-26(19-23)47-29-20-30(39)37(34(29)42)24-14-16-25(17-15-24)38(43)44/h3-19,29H,20H2,1-2H3,(H,35,41)(H,36,40)/b27-18- |
| InChIKey | WFTNFDPJYZLPNO-IMRQLAEWSA-N |
| XLogP | 5.45 |
| TPSA | 157.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.69 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|