C36H31N3O9S — CID 124656929
4-[(3S)-3-[3-[[(E)-2-benzamido-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoic acid (PubChem CID 124656929) has the molecular formula C36H31N3O9S and a molecular weight of 681.72 g/mol. Its IUPAC name is 4-[(3S)-3-[3-[[(E)-2-benzamido-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoic acid.
| Compound Name | 4-[(3S)-3-[3-[[(E)-2-benzamido-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 124656929 |
| Molecular Formula | C36H31N3O9S |
| Molecular Weight | 681.72 g/mol |
| Exact Mass | 681.18 |
| IUPAC Name | 4-[(3S)-3-[3-[[(E)-2-benzamido-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoic acid |
| SMILES | COc1cc(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cccc(S[C@H]3CC(=O)N(c4ccc(C(=O)O)cc4)C3=O)c2)cc(OC)c1OC |
| InChI | InChI=1S/C36H31N3O9S/c1-46-28-17-21(18-29(47-2)32(28)48-3)16-27(38-33(41)22-8-5-4-6-9-22)34(42)37-24-10-7-11-26(19-24)49-30-20-31(40)39(35(30)43)25-14-12-23(13-15-25)36(44)45/h4-19,30H,20H2,1-3H3,(H,37,42)(H,38,41)(H,44,45)/b27-16+/t30-/m0/s1 |
| InChIKey | AURKPAYKPQFGBS-JGAIACPSSA-N |
| XLogP | 5.24 |
| TPSA | 160.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.72 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|