C34H28ClN3O6S — CID 21172354
N-[(Z)-3-[4-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-1-(3,4-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 21172354) has the molecular formula C34H28ClN3O6S and a molecular weight of 642.13 g/mol. Its IUPAC name is N-[(Z)-3-[4-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-1-(3,4-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-1-(3,4-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21172354 |
| Molecular Formula | C34H28ClN3O6S |
| Molecular Weight | 642.13 g/mol |
| Exact Mass | 641.14 |
| IUPAC Name | N-[(Z)-3-[4-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-1-(3,4-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SC3CC(=O)N(c4ccc(Cl)cc4)C3=O)cc2)cc1OC |
| InChI | InChI=1S/C34H28ClN3O6S/c1-43-28-17-8-21(19-29(28)44-2)18-27(37-32(40)22-6-4-3-5-7-22)33(41)36-24-11-15-26(16-12-24)45-30-20-31(39)38(34(30)42)25-13-9-23(35)10-14-25/h3-19,30H,20H2,1-2H3,(H,36,41)(H,37,40)/b27-18- |
| InChIKey | OTEZBKLFHIQDEF-IMRQLAEWSA-N |
| XLogP | 6.19 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.13 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|