C32H24FN3O4S — CID 21170374
N-[(Z)-3-[4-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide (PubChem CID 21170374) has the molecular formula C32H24FN3O4S and a molecular weight of 565.63 g/mol. Its IUPAC name is N-[(Z)-3-[4-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21170374 |
| Molecular Formula | C32H24FN3O4S |
| Molecular Weight | 565.63 g/mol |
| Exact Mass | 565.15 |
| IUPAC Name | N-[(Z)-3-[4-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(SC2CC(=O)N(c3ccc(F)cc3)C2=O)cc1)/C(=C/c1ccccc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C32H24FN3O4S/c33-23-11-15-25(16-12-23)36-29(37)20-28(32(36)40)41-26-17-13-24(14-18-26)34-31(39)27(19-21-7-3-1-4-8-21)35-30(38)22-9-5-2-6-10-22/h1-19,28H,20H2,(H,34,39)(H,35,38)/b27-19- |
| InChIKey | MZTUFMWZKNBZEK-DIBXZPPDSA-N |
| XLogP | 5.66 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.63 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|