C30H22ClN3O4S2 — CID 21171144
N-[(Z)-3-[4-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide (PubChem CID 21171144) has the molecular formula C30H22ClN3O4S2 and a molecular weight of 588.11 g/mol. Its IUPAC name is N-[(Z)-3-[4-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21171144 |
| Molecular Formula | C30H22ClN3O4S2 |
| Molecular Weight | 588.11 g/mol |
| Exact Mass | 587.07 |
| IUPAC Name | N-[(Z)-3-[4-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(SC2CC(=O)N(c3ccc(Cl)cc3)C2=O)cc1)/C(=C/c1ccsc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H22ClN3O4S2/c31-21-6-10-23(11-7-21)34-27(35)17-26(30(34)38)40-24-12-8-22(9-13-24)32-29(37)25(16-19-14-15-39-18-19)33-28(36)20-4-2-1-3-5-20/h1-16,18,26H,17H2,(H,32,37)(H,33,36)/b25-16- |
| InChIKey | FBAURVCXMMRONJ-XYGWBWBKSA-N |
| XLogP | 6.24 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.11 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|