C32H24N4O6S — CID 21171284
N-[(Z)-3-[4-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 21171284) has the molecular formula C32H24N4O6S and a molecular weight of 592.63 g/mol. Its IUPAC name is N-[(Z)-3-[4-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21171284 |
| Molecular Formula | C32H24N4O6S |
| Molecular Weight | 592.63 g/mol |
| Exact Mass | 592.14 |
| IUPAC Name | N-[(Z)-3-[4-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(SC2CC(=O)N(c3ccccc3)C2=O)cc1)/C(=C/c1ccc([N+](=O)[O-])cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C32H24N4O6S/c37-29-20-28(32(40)35(29)24-9-5-2-6-10-24)43-26-17-13-23(14-18-26)33-31(39)27(34-30(38)22-7-3-1-4-8-22)19-21-11-15-25(16-12-21)36(41)42/h1-19,28H,20H2,(H,33,39)(H,34,38)/b27-19- |
| InChIKey | ICAAKLKUAYPHPF-DIBXZPPDSA-N |
| XLogP | 5.43 |
| TPSA | 138.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.63 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|