C32H25N5O8S2 — CID 21172798
N-[(Z)-3-[4-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 21172798) has the molecular formula C32H25N5O8S2 and a molecular weight of 671.71 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21172798 |
| Molecular Formula | C32H25N5O8S2 |
| Molecular Weight | 671.71 g/mol |
| Exact Mass | 671.11 |
| IUPAC Name | N-[(Z)-3-[4-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | NS(=O)(=O)c1ccc(N2C(=O)CC(Sc3ccc(NC(=O)/C(=C/c4ccc([N+](=O)[O-])cc4)NC(=O)c4ccccc4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C32H25N5O8S2/c33-47(44,45)26-16-12-23(13-17-26)36-29(38)19-28(32(36)41)46-25-14-8-22(9-15-25)34-31(40)27(35-30(39)21-4-2-1-3-5-21)18-20-6-10-24(11-7-20)37(42)43/h1-18,28H,19H2,(H,34,40)(H,35,39)(H2,33,44,45)/b27-18- |
| InChIKey | SXPULWJMKWTHDC-IMRQLAEWSA-N |
| XLogP | 4.08 |
| TPSA | 198.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.71 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|