C32H22Cl2N4O6S — CID 21172656
N-[(Z)-1-(2,6-dichlorophenyl)-3-[4-[1-(4-nitrophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 21172656) has the molecular formula C32H22Cl2N4O6S and a molecular weight of 661.52 g/mol. Its IUPAC name is N-[(Z)-1-(2,6-dichlorophenyl)-3-[4-[1-(4-nitrophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2,6-dichlorophenyl)-3-[4-[1-(4-nitrophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21172656 |
| Molecular Formula | C32H22Cl2N4O6S |
| Molecular Weight | 661.52 g/mol |
| Exact Mass | 660.06 |
| IUPAC Name | N-[(Z)-1-(2,6-dichlorophenyl)-3-[4-[1-(4-nitrophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(SC2CC(=O)N(c3ccc([N+](=O)[O-])cc3)C2=O)cc1)/C(=C/c1c(Cl)cccc1Cl)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C32H22Cl2N4O6S/c33-25-7-4-8-26(34)24(25)17-27(36-30(40)19-5-2-1-3-6-19)31(41)35-20-9-15-23(16-10-20)45-28-18-29(39)37(32(28)42)21-11-13-22(14-12-21)38(43)44/h1-17,28H,18H2,(H,35,41)(H,36,40)/b27-17- |
| InChIKey | IWDYSTNCZMTWTA-PKAZHMFMSA-N |
| XLogP | 6.74 |
| TPSA | 138.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.52 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|