C33H26N4O6S — CID 21171639
N-[(Z)-1-(4-methylphenyl)-3-[4-[1-(4-nitrophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 21171639) has the molecular formula C33H26N4O6S and a molecular weight of 606.66 g/mol. Its IUPAC name is N-[(Z)-1-(4-methylphenyl)-3-[4-[1-(4-nitrophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(4-methylphenyl)-3-[4-[1-(4-nitrophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21171639 |
| Molecular Formula | C33H26N4O6S |
| Molecular Weight | 606.66 g/mol |
| Exact Mass | 606.16 |
| IUPAC Name | N-[(Z)-1-(4-methylphenyl)-3-[4-[1-(4-nitrophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SC3CC(=O)N(c4ccc([N+](=O)[O-])cc4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C33H26N4O6S/c1-21-7-9-22(10-8-21)19-28(35-31(39)23-5-3-2-4-6-23)32(40)34-24-11-17-27(18-12-24)44-29-20-30(38)36(33(29)41)25-13-15-26(16-14-25)37(42)43/h2-19,29H,20H2,1H3,(H,34,40)(H,35,39)/b28-19- |
| InChIKey | DAPPQGALPDDCPJ-USHMODERSA-N |
| XLogP | 5.74 |
| TPSA | 138.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.66 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|