C33H26BrN3O4S — CID 21172327
N-[(Z)-1-(3-bromophenyl)-3-[4-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 21172327) has the molecular formula C33H26BrN3O4S and a molecular weight of 640.56 g/mol. Its IUPAC name is N-[(Z)-1-(3-bromophenyl)-3-[4-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(3-bromophenyl)-3-[4-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21172327 |
| Molecular Formula | C33H26BrN3O4S |
| Molecular Weight | 640.56 g/mol |
| Exact Mass | 639.08 |
| IUPAC Name | N-[(Z)-1-(3-bromophenyl)-3-[4-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1ccc(N2C(=O)CC(Sc3ccc(NC(=O)/C(=C/c4cccc(Br)c4)NC(=O)c4ccccc4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C33H26BrN3O4S/c1-21-10-14-26(15-11-21)37-30(38)20-29(33(37)41)42-27-16-12-25(13-17-27)35-32(40)28(19-22-6-5-9-24(34)18-22)36-31(39)23-7-3-2-4-8-23/h2-19,29H,20H2,1H3,(H,35,40)(H,36,39)/b28-19- |
| InChIKey | GLRBFKBIQYOBGD-USHMODERSA-N |
| XLogP | 6.59 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.56 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|