C39H31N5O4S — CID 21172714
N-[(Z)-3-[4-[2,5-dioxo-1-(4-phenyldiazenylphenyl)pyrrolidin-3-yl]sulfanylanilino]-1-(3-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 21172714) has the molecular formula C39H31N5O4S and a molecular weight of 665.78 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2,5-dioxo-1-(4-phenyldiazenylphenyl)pyrrolidin-3-yl]sulfanylanilino]-1-(3-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2,5-dioxo-1-(4-phenyldiazenylphenyl)pyrrolidin-3-yl]sulfanylanilino]-1-(3-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21172714 |
| Molecular Formula | C39H31N5O4S |
| Molecular Weight | 665.78 g/mol |
| Exact Mass | 665.21 |
| IUPAC Name | N-[(Z)-3-[4-[2,5-dioxo-1-(4-phenyldiazenylphenyl)pyrrolidin-3-yl]sulfanylanilino]-1-(3-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1cccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SC3CC(=O)N(c4ccc(/N=N/c5ccccc5)cc4)C3=O)cc2)c1 |
| InChI | InChI=1S/C39H31N5O4S/c1-26-9-8-10-27(23-26)24-34(41-37(46)28-11-4-2-5-12-28)38(47)40-29-17-21-33(22-18-29)49-35-25-36(45)44(39(35)48)32-19-15-31(16-20-32)43-42-30-13-6-3-7-14-30/h2-24,35H,25H2,1H3,(H,40,47)(H,41,46)/b34-24-,43-42+ |
| InChIKey | DEHKYTNRIVZAIY-DAXOXYKHSA-N |
| XLogP | 8.24 |
| TPSA | 120.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.78 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|