C33H25FN4O5S — CID 21171697
4-[3-[4-[[(Z)-2-benzamido-3-(4-fluorophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzamide (PubChem CID 21171697) has the molecular formula C33H25FN4O5S and a molecular weight of 608.65 g/mol. Its IUPAC name is 4-[3-[4-[[(Z)-2-benzamido-3-(4-fluorophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzamide.
| Compound Name | 4-[3-[4-[[(Z)-2-benzamido-3-(4-fluorophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzamide |
|---|---|
| PubChem CID | 21171697 |
| Molecular Formula | C33H25FN4O5S |
| Molecular Weight | 608.65 g/mol |
| Exact Mass | 608.15 |
| IUPAC Name | 4-[3-[4-[[(Z)-2-benzamido-3-(4-fluorophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzamide |
| SMILES | NC(=O)c1ccc(N2C(=O)CC(Sc3ccc(NC(=O)/C(=C/c4ccc(F)cc4)NC(=O)c4ccccc4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C33H25FN4O5S/c34-23-10-6-20(7-11-23)18-27(37-31(41)22-4-2-1-3-5-22)32(42)36-24-12-16-26(17-13-24)44-28-19-29(39)38(33(28)43)25-14-8-21(9-15-25)30(35)40/h1-18,28H,19H2,(H2,35,40)(H,36,42)(H,37,41)/b27-18- |
| InChIKey | CQJHEVWSEDLAFI-IMRQLAEWSA-N |
| XLogP | 4.76 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.65 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|