C34H28N4O5S — CID 21171580
N-[(Z)-3-[4-[1-(4-acetamidophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide (PubChem CID 21171580) has the molecular formula C34H28N4O5S and a molecular weight of 604.69 g/mol. Its IUPAC name is N-[(Z)-3-[4-[1-(4-acetamidophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[1-(4-acetamidophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21171580 |
| Molecular Formula | C34H28N4O5S |
| Molecular Weight | 604.69 g/mol |
| Exact Mass | 604.18 |
| IUPAC Name | N-[(Z)-3-[4-[1-(4-acetamidophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide |
| SMILES | CC(=O)Nc1ccc(N2C(=O)CC(Sc3ccc(NC(=O)/C(=C/c4ccccc4)NC(=O)c4ccccc4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C34H28N4O5S/c1-22(39)35-25-12-16-27(17-13-25)38-31(40)21-30(34(38)43)44-28-18-14-26(15-19-28)36-33(42)29(20-23-8-4-2-5-9-23)37-32(41)24-10-6-3-7-11-24/h2-20,30H,21H2,1H3,(H,35,39)(H,36,42)(H,37,41)/b29-20- |
| InChIKey | WFNSEOXITJYLGM-BRPDVVIDSA-N |
| XLogP | 5.48 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.69 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|