C33H25N5O7S — CID 21172239
4-[3-[4-[[(E)-2-benzamido-3-(2-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzamide (PubChem CID 21172239) has the molecular formula C33H25N5O7S and a molecular weight of 635.66 g/mol. Its IUPAC name is 4-[3-[4-[[(E)-2-benzamido-3-(2-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzamide.
| Compound Name | 4-[3-[4-[[(E)-2-benzamido-3-(2-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzamide |
|---|---|
| PubChem CID | 21172239 |
| Molecular Formula | C33H25N5O7S |
| Molecular Weight | 635.66 g/mol |
| Exact Mass | 635.15 |
| IUPAC Name | 4-[3-[4-[[(E)-2-benzamido-3-(2-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzamide |
| SMILES | NC(=O)c1ccc(N2C(=O)CC(Sc3ccc(NC(=O)/C(=C\c4ccccc4[N+](=O)[O-])NC(=O)c4ccccc4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C33H25N5O7S/c34-30(40)20-10-14-24(15-11-20)37-29(39)19-28(33(37)43)46-25-16-12-23(13-17-25)35-32(42)26(36-31(41)21-6-2-1-3-7-21)18-22-8-4-5-9-27(22)38(44)45/h1-18,28H,19H2,(H2,34,40)(H,35,42)(H,36,41)/b26-18+ |
| InChIKey | BRCLEEGXEVALDX-NLRVBDNBSA-N |
| XLogP | 4.53 |
| TPSA | 181.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.66 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|