C35H28ClN3O6S — CID 21172548
ethyl 4-[3-[4-[[(Z)-2-benzamido-3-(2-chlorophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 21172548) has the molecular formula C35H28ClN3O6S and a molecular weight of 654.14 g/mol. Its IUPAC name is ethyl 4-[3-[4-[[(Z)-2-benzamido-3-(2-chlorophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[3-[4-[[(Z)-2-benzamido-3-(2-chlorophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 21172548 |
| Molecular Formula | C35H28ClN3O6S |
| Molecular Weight | 654.14 g/mol |
| Exact Mass | 653.14 |
| IUPAC Name | ethyl 4-[3-[4-[[(Z)-2-benzamido-3-(2-chlorophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)CC(Sc3ccc(NC(=O)/C(=C/c4ccccc4Cl)NC(=O)c4ccccc4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C35H28ClN3O6S/c1-2-45-35(44)23-12-16-26(17-13-23)39-31(40)21-30(34(39)43)46-27-18-14-25(15-19-27)37-33(42)29(20-24-10-6-7-11-28(24)36)38-32(41)22-8-4-3-5-9-22/h3-20,30H,2,21H2,1H3,(H,37,42)(H,38,41)/b29-20- |
| InChIKey | OVMLIHOXQBZKCY-BRPDVVIDSA-N |
| XLogP | 6.35 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.14 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|