C34H25ClFN3O5S — CID 21172353
N-[(Z)-3-[4-[1-(4-acetylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-1-(2-chloro-6-fluorophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 21172353) has the molecular formula C34H25ClFN3O5S and a molecular weight of 642.11 g/mol. Its IUPAC name is N-[(Z)-3-[4-[1-(4-acetylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-1-(2-chloro-6-fluorophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[1-(4-acetylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-1-(2-chloro-6-fluorophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21172353 |
| Molecular Formula | C34H25ClFN3O5S |
| Molecular Weight | 642.11 g/mol |
| Exact Mass | 641.12 |
| IUPAC Name | N-[(Z)-3-[4-[1-(4-acetylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-1-(2-chloro-6-fluorophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CC(=O)c1ccc(N2C(=O)CC(Sc3ccc(NC(=O)/C(=C/c4c(F)cccc4Cl)NC(=O)c4ccccc4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C34H25ClFN3O5S/c1-20(40)21-10-14-24(15-11-21)39-31(41)19-30(34(39)44)45-25-16-12-23(13-17-25)37-33(43)29(18-26-27(35)8-5-9-28(26)36)38-32(42)22-6-3-2-4-7-22/h2-18,30H,19H2,1H3,(H,37,43)(H,38,42)/b29-18- |
| InChIKey | WLECLOTWZCFZKC-MIXAMLLLSA-N |
| XLogP | 6.52 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.11 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|