C27H21Cl2N3O4S — CID 18893590
N-[(Z)-1-(2,6-dichlorophenyl)-3-[4-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 18893590) has the molecular formula C27H21Cl2N3O4S and a molecular weight of 554.46 g/mol. Its IUPAC name is N-[(Z)-1-(2,6-dichlorophenyl)-3-[4-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2,6-dichlorophenyl)-3-[4-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 18893590 |
| Molecular Formula | C27H21Cl2N3O4S |
| Molecular Weight | 554.46 g/mol |
| Exact Mass | 553.06 |
| IUPAC Name | N-[(Z)-1-(2,6-dichlorophenyl)-3-[4-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CN1C(=O)CC(Sc2ccc(NC(=O)/C(=C/c3c(Cl)cccc3Cl)NC(=O)c3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C27H21Cl2N3O4S/c1-32-24(33)15-23(27(32)36)37-18-12-10-17(11-13-18)30-26(35)22(14-19-20(28)8-5-9-21(19)29)31-25(34)16-6-3-2-4-7-16/h2-14,23H,15H2,1H3,(H,30,35)(H,31,34)/b22-14- |
| InChIKey | UNGQOKWBZKYDTE-HMAPJEAMSA-N |
| XLogP | 5.25 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.46 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|