C32H27N3O4S2 — CID 21170935
N-[(Z)-3-[4-[1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide (PubChem CID 21170935) has the molecular formula C32H27N3O4S2 and a molecular weight of 581.72 g/mol. Its IUPAC name is N-[(Z)-3-[4-[1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21170935 |
| Molecular Formula | C32H27N3O4S2 |
| Molecular Weight | 581.72 g/mol |
| Exact Mass | 581.14 |
| IUPAC Name | N-[(Z)-3-[4-[1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide |
| SMILES | Cc1cccc(C)c1N1C(=O)CC(Sc2ccc(NC(=O)/C(=C/c3ccsc3)NC(=O)c3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C32H27N3O4S2/c1-20-7-6-8-21(2)29(20)35-28(36)18-27(32(35)39)41-25-13-11-24(12-14-25)33-31(38)26(17-22-15-16-40-19-22)34-30(37)23-9-4-3-5-10-23/h3-17,19,27H,18H2,1-2H3,(H,33,38)(H,34,37)/b26-17- |
| InChIKey | ZYYKXLNRBNTORY-ONUIUJJFSA-N |
| XLogP | 6.20 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.72 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|