C34H27Cl2N3O4S — CID 21172386
N-[(Z)-1-(2,3-dichlorophenyl)-3-[4-[1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 21172386) has the molecular formula C34H27Cl2N3O4S and a molecular weight of 644.58 g/mol. Its IUPAC name is N-[(Z)-1-(2,3-dichlorophenyl)-3-[4-[1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2,3-dichlorophenyl)-3-[4-[1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21172386 |
| Molecular Formula | C34H27Cl2N3O4S |
| Molecular Weight | 644.58 g/mol |
| Exact Mass | 643.11 |
| IUPAC Name | N-[(Z)-1-(2,3-dichlorophenyl)-3-[4-[1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1cccc(C)c1N1C(=O)CC(Sc2ccc(NC(=O)/C(=C/c3cccc(Cl)c3Cl)NC(=O)c3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C34H27Cl2N3O4S/c1-20-8-6-9-21(2)31(20)39-29(40)19-28(34(39)43)44-25-16-14-24(15-17-25)37-33(42)27(18-23-12-7-13-26(35)30(23)36)38-32(41)22-10-4-3-5-11-22/h3-18,28H,19H2,1-2H3,(H,37,42)(H,38,41)/b27-18- |
| InChIKey | DTROVDGZFWWDEG-IMRQLAEWSA-N |
| XLogP | 7.44 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.58 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|