C29H27N3O6S — CID 18893593
N-[(Z)-1-(2,5-dimethoxyphenyl)-3-[4-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 18893593) has the molecular formula C29H27N3O6S and a molecular weight of 545.62 g/mol. Its IUPAC name is N-[(Z)-1-(2,5-dimethoxyphenyl)-3-[4-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2,5-dimethoxyphenyl)-3-[4-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 18893593 |
| Molecular Formula | C29H27N3O6S |
| Molecular Weight | 545.62 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | N-[(Z)-1-(2,5-dimethoxyphenyl)-3-[4-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(OC)c(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SC3CC(=O)N(C)C3=O)cc2)c1 |
| InChI | InChI=1S/C29H27N3O6S/c1-32-26(33)17-25(29(32)36)39-22-12-9-20(10-13-22)30-28(35)23(31-27(34)18-7-5-4-6-8-18)16-19-15-21(37-2)11-14-24(19)38-3/h4-16,25H,17H2,1-3H3,(H,30,35)(H,31,34)/b23-16- |
| InChIKey | SYMPRRLCHJUKKP-KQWNVCNZSA-N |
| XLogP | 3.96 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.62 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|