C33H27N3O7S — CID 99129533
ethyl 4-[(3S)-3-[3-[[(Z)-2-benzamido-3-(furan-2-yl)prop-2-enoyl]amino]phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 99129533) has the molecular formula C33H27N3O7S and a molecular weight of 609.66 g/mol. Its IUPAC name is ethyl 4-[(3S)-3-[3-[[(Z)-2-benzamido-3-(furan-2-yl)prop-2-enoyl]amino]phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[(3S)-3-[3-[[(Z)-2-benzamido-3-(furan-2-yl)prop-2-enoyl]amino]phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 99129533 |
| Molecular Formula | C33H27N3O7S |
| Molecular Weight | 609.66 g/mol |
| Exact Mass | 609.16 |
| IUPAC Name | ethyl 4-[(3S)-3-[3-[[(Z)-2-benzamido-3-(furan-2-yl)prop-2-enoyl]amino]phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C[C@H](Sc3cccc(NC(=O)/C(=C/c4ccco4)NC(=O)c4ccccc4)c3)C2=O)cc1 |
| InChI | InChI=1S/C33H27N3O7S/c1-2-42-33(41)22-13-15-24(16-14-22)36-29(37)20-28(32(36)40)44-26-12-6-10-23(18-26)34-31(39)27(19-25-11-7-17-43-25)35-30(38)21-8-4-3-5-9-21/h3-19,28H,2,20H2,1H3,(H,34,39)(H,35,38)/b27-19-/t28-/m0/s1 |
| InChIKey | XZYFBLPPQRYISE-PQPBAKKCSA-N |
| XLogP | 5.29 |
| TPSA | 135.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.66 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|