C31H24BrN3O5S — CID 99679578
N-[(E)-3-[3-[(3S)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-1-(5-methylfuran-2-yl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 99679578) has the molecular formula C31H24BrN3O5S and a molecular weight of 630.52 g/mol. Its IUPAC name is N-[(E)-3-[3-[(3S)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-1-(5-methylfuran-2-yl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[(3S)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-1-(5-methylfuran-2-yl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 99679578 |
| Molecular Formula | C31H24BrN3O5S |
| Molecular Weight | 630.52 g/mol |
| Exact Mass | 629.06 |
| IUPAC Name | N-[(E)-3-[3-[(3S)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-1-(5-methylfuran-2-yl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1ccc(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cccc(S[C@H]3CC(=O)N(c4ccc(Br)cc4)C3=O)c2)o1 |
| InChI | InChI=1S/C31H24BrN3O5S/c1-19-10-15-24(40-19)17-26(34-29(37)20-6-3-2-4-7-20)30(38)33-22-8-5-9-25(16-22)41-27-18-28(36)35(31(27)39)23-13-11-21(32)12-14-23/h2-17,27H,18H2,1H3,(H,33,38)(H,34,37)/b26-17+/t27-/m0/s1 |
| InChIKey | KTVYQPANGBBROF-DVFLESNOSA-N |
| XLogP | 6.18 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.52 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|