C30H21Cl2N3O5S — CID 99129934
N-[(Z)-3-[3-[(3S)-1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 99129934) has the molecular formula C30H21Cl2N3O5S and a molecular weight of 606.49 g/mol. Its IUPAC name is N-[(Z)-3-[3-[(3S)-1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[(3S)-1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 99129934 |
| Molecular Formula | C30H21Cl2N3O5S |
| Molecular Weight | 606.49 g/mol |
| Exact Mass | 605.06 |
| IUPAC Name | N-[(Z)-3-[3-[(3S)-1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1cccc(S[C@H]2CC(=O)N(c3ccc(Cl)c(Cl)c3)C2=O)c1)/C(=C/c1ccco1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H21Cl2N3O5S/c31-23-12-11-20(15-24(23)32)35-27(36)17-26(30(35)39)41-22-10-4-8-19(14-22)33-29(38)25(16-21-9-5-13-40-21)34-28(37)18-6-2-1-3-7-18/h1-16,26H,17H2,(H,33,38)(H,34,37)/b25-16-/t26-/m0/s1 |
| InChIKey | LLADPOHOHKVILD-HMUDIZEXSA-N |
| XLogP | 6.42 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.49 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|