C30H23N3O5S — CID 21168837
N-[(Z)-3-[4-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanylanilino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 21168837) has the molecular formula C30H23N3O5S and a molecular weight of 537.60 g/mol. Its IUPAC name is N-[(Z)-3-[4-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanylanilino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanylanilino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21168837 |
| Molecular Formula | C30H23N3O5S |
| Molecular Weight | 537.60 g/mol |
| Exact Mass | 537.14 |
| IUPAC Name | N-[(Z)-3-[4-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanylanilino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(SC2CC(=O)N(c3ccccc3)C2=O)cc1)/C(=C/c1ccco1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H23N3O5S/c34-27-19-26(30(37)33(27)22-10-5-2-6-11-22)39-24-15-13-21(14-16-24)31-29(36)25(18-23-12-7-17-38-23)32-28(35)20-8-3-1-4-9-20/h1-18,26H,19H2,(H,31,36)(H,32,35)/b25-18- |
| InChIKey | NZDBKUUPOHZELG-BWAHOGKJSA-N |
| XLogP | 5.11 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.60 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|