C37H33N3O7S — CID 21172679
ethyl 4-[3-[4-[[(Z)-2-benzamido-3-(4-ethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 21172679) has the molecular formula C37H33N3O7S and a molecular weight of 663.75 g/mol. Its IUPAC name is ethyl 4-[3-[4-[[(Z)-2-benzamido-3-(4-ethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[3-[4-[[(Z)-2-benzamido-3-(4-ethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 21172679 |
| Molecular Formula | C37H33N3O7S |
| Molecular Weight | 663.75 g/mol |
| Exact Mass | 663.20 |
| IUPAC Name | ethyl 4-[3-[4-[[(Z)-2-benzamido-3-(4-ethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)CC(Sc3ccc(NC(=O)/C(=C/c4ccc(OCC)cc4)NC(=O)c4ccccc4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C37H33N3O7S/c1-3-46-29-18-10-24(11-19-29)22-31(39-34(42)25-8-6-5-7-9-25)35(43)38-27-14-20-30(21-15-27)48-32-23-33(41)40(36(32)44)28-16-12-26(13-17-28)37(45)47-4-2/h5-22,32H,3-4,23H2,1-2H3,(H,38,43)(H,39,42)/b31-22- |
| InChIKey | FURNBWCGRLXFMC-VAMRJTSQSA-N |
| XLogP | 6.10 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.75 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|