C39H27N5O7S — CID 21173088
N-[(Z)-3-[4-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 21173088) has the molecular formula C39H27N5O7S and a molecular weight of 709.74 g/mol. Its IUPAC name is N-[(Z)-3-[4-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21173088 |
| Molecular Formula | C39H27N5O7S |
| Molecular Weight | 709.74 g/mol |
| Exact Mass | 709.16 |
| IUPAC Name | N-[(Z)-3-[4-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(SC2CC(=O)N(c3ccc(-c4nc5ccccc5o4)cc3)C2=O)cc1)/C(=C/c1ccc([N+](=O)[O-])cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C39H27N5O7S/c45-35-23-34(39(48)43(35)28-18-12-26(13-19-28)38-42-31-8-4-5-9-33(31)51-38)52-30-20-14-27(15-21-30)40-37(47)32(41-36(46)25-6-2-1-3-7-25)22-24-10-16-29(17-11-24)44(49)50/h1-22,34H,23H2,(H,40,47)(H,41,46)/b32-22- |
| InChIKey | IDOMNUORUIGITM-JDCMOKTRSA-N |
| XLogP | 7.24 |
| TPSA | 164.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.74 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|