C37H26N4O5S2 — CID 99679357
N-[(E)-3-[3-[(3R)-1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide (PubChem CID 99679357) has the molecular formula C37H26N4O5S2 and a molecular weight of 670.77 g/mol. Its IUPAC name is N-[(E)-3-[3-[(3R)-1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[(3R)-1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 99679357 |
| Molecular Formula | C37H26N4O5S2 |
| Molecular Weight | 670.77 g/mol |
| Exact Mass | 670.13 |
| IUPAC Name | N-[(E)-3-[3-[(3R)-1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1cccc(S[C@@H]2CC(=O)N(c3ccc(-c4nc5ccccc5o4)cc3)C2=O)c1)/C(=C\c1cccs1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C37H26N4O5S2/c42-33-22-32(37(45)41(33)26-17-15-24(16-18-26)36-40-29-13-4-5-14-31(29)46-36)48-28-11-6-10-25(20-28)38-35(44)30(21-27-12-7-19-47-27)39-34(43)23-8-2-1-3-9-23/h1-21,32H,22H2,(H,38,44)(H,39,43)/b30-21+/t32-/m1/s1 |
| InChIKey | KPTVMGNASPCZLL-NSQMGQQPSA-N |
| XLogP | 7.39 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.77 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|