C40H30ClN3O8S — CID 99679685
N-[(Z)-3-[3-[(3R)-1-[4-(4-chlorophenoxy)phenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-1-(7-methoxy-1,3-benzodioxol-5-yl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 99679685) has the molecular formula C40H30ClN3O8S and a molecular weight of 748.21 g/mol. Its IUPAC name is N-[(Z)-3-[3-[(3R)-1-[4-(4-chlorophenoxy)phenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-1-(7-methoxy-1,3-benzodioxol-5-yl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[(3R)-1-[4-(4-chlorophenoxy)phenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-1-(7-methoxy-1,3-benzodioxol-5-yl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 99679685 |
| Molecular Formula | C40H30ClN3O8S |
| Molecular Weight | 748.21 g/mol |
| Exact Mass | 747.14 |
| IUPAC Name | N-[(Z)-3-[3-[(3R)-1-[4-(4-chlorophenoxy)phenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-1-(7-methoxy-1,3-benzodioxol-5-yl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1cc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2cccc(S[C@@H]3CC(=O)N(c4ccc(Oc5ccc(Cl)cc5)cc4)C3=O)c2)cc2c1OCO2 |
| InChI | InChI=1S/C40H30ClN3O8S/c1-49-33-19-24(20-34-37(33)51-23-50-34)18-32(43-38(46)25-6-3-2-4-7-25)39(47)42-27-8-5-9-31(21-27)53-35-22-36(45)44(40(35)48)28-12-16-30(17-13-28)52-29-14-10-26(41)11-15-29/h2-21,35H,22-23H2,1H3,(H,42,47)(H,43,46)/b32-18-/t35-/m1/s1 |
| InChIKey | MGKFNSAWKHHEPL-QBXSFHPBSA-N |
| XLogP | 7.70 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.21 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|